About 4,4-dihydroxybutanamide
4,4-dihydroxybutanamide (PubChem CID 20522515) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 4,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | 4,4-dihydroxybutanamide |
| PubChem CID | 20522515 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 4,4-dihydroxybutanamide |
| SMILES | NC(=O)CCC(O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(6)1-2-4(7)8/h4,7-8H,1-2H2,(H2,5,6) |
| InChIKey | DAFOZSWKZSQPAM-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dihydroxybutanamide?
The IUPAC name of 4,4-dihydroxybutanamide (CID 20522515) is 4,4-dihydroxybutanamide.
What is the SMILES notation for 4,4-dihydroxybutanamide?
The canonical SMILES for 4,4-dihydroxybutanamide is NC(=O)CCC(O)O.
What is the InChIKey of 4,4-dihydroxybutanamide?
The InChIKey is DAFOZSWKZSQPAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c5-3(6)1-2-4(7)8/h4,7-8H,1-2H2,(H2,5,6).
What are the key properties of 4,4-dihydroxybutanamide?
4,4-dihydroxybutanamide has a molecular weight of 119.12 g/mol, XLogP of -1.44, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dihydroxybutanamide is sourced from PubChem (CID 20522515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).