About 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine
1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine (PubChem CID 20522892) has the molecular formula C13H13BrO3
and a molecular weight of 297.15 g/mol. Its IUPAC name is 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine.
Molecular Properties
| Compound Name | 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine |
| PubChem CID | 20522892 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine |
| SMILES | COc1cc2c(cc1OC)=C(CBr)OC=CC=2 |
| InChI | InChI=1S/C13H13BrO3/c1-15-11-6-9-4-3-5-17-13(8-14)10(9)7-12(11)16-2/h3-7H,8H2,1-2H3 |
| InChIKey | AQIRGSHRPWQPIV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine?
The IUPAC name of 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine (CID 20522892) is 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine.
What is the SMILES notation for 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine?
The canonical SMILES for 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine is COc1cc2c(cc1OC)=C(CBr)OC=CC=2.
What is the InChIKey of 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine?
The InChIKey is AQIRGSHRPWQPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO3/c1-15-11-6-9-4-3-5-17-13(8-14)10(9)7-12(11)16-2/h3-7H,8H2,1-2H3.
What are the key properties of 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine?
1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine has a molecular weight of 297.15 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-7,8-dimethoxy-2-benzoxepine is sourced from PubChem (CID 20522892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).