C22H33ClO2S — CID 20522994
1-(3-chloropropyl)-1-methyl-7,8-dipropoxy-3,3a,5,9b-tetrahydro-2H-cyclopenta[c]isothiochromene (PubChem CID 20522994) has the molecular formula C22H33ClO2S and a molecular weight of 397.02 g/mol. Its IUPAC name is 1-(3-chloropropyl)-1-methyl-7,8-dipropoxy-3,3a,5,9b-tetrahydro-2H-cyclopenta[c]isothiochromene.
| Compound Name | 1-(3-chloropropyl)-1-methyl-7,8-dipropoxy-3,3a,5,9b-tetrahydro-2H-cyclopenta[c]isothiochromene |
|---|---|
| PubChem CID | 20522994 |
| Molecular Formula | C22H33ClO2S |
| Molecular Weight | 397.02 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-(3-chloropropyl)-1-methyl-7,8-dipropoxy-3,3a,5,9b-tetrahydro-2H-cyclopenta[c]isothiochromene |
| SMILES | CCCOc1cc2c(cc1OCCC)C1C(CCC1(C)CCCCl)SC2 |
| InChI | InChI=1S/C22H33ClO2S/c1-4-11-24-18-13-16-15-26-20-7-9-22(3,8-6-10-23)21(20)17(16)14-19(18)25-12-5-2/h13-14,20-21H,4-12,15H2,1-3H3 |
| InChIKey | KITSNYFDWSOJTF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.02 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|