About N,N'-diphenylhexanediamide
N,N'-diphenylhexanediamide (PubChem CID 20523) has the molecular formula C18H20N2O2
and a molecular weight of 296.37 g/mol. Its IUPAC name is N,N'-diphenylhexanediamide.
Molecular Properties
| Compound Name | N,N'-diphenylhexanediamide |
| PubChem CID | 20523 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N,N'-diphenylhexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c21-17(19-15-9-3-1-4-10-15)13-7-8-14-18(22)20-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,19,21)(H,20,22) |
| InChIKey | QZLPDBKEVWFQNF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diphenylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diphenylhexanediamide?
The IUPAC name of N,N'-diphenylhexanediamide (CID 20523) is N,N'-diphenylhexanediamide.
What is the SMILES notation for N,N'-diphenylhexanediamide?
The canonical SMILES for N,N'-diphenylhexanediamide is O=C(CCCCC(=O)Nc1ccccc1)Nc1ccccc1.
What is the InChIKey of N,N'-diphenylhexanediamide?
The InChIKey is QZLPDBKEVWFQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2/c21-17(19-15-9-3-1-4-10-15)13-7-8-14-18(22)20-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,19,21)(H,20,22).
What are the key properties of N,N'-diphenylhexanediamide?
N,N'-diphenylhexanediamide has a molecular weight of 296.37 g/mol, XLogP of 3.82, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diphenylhexanediamide is sourced from PubChem (CID 20523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).