About 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole
3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 20523258) has the molecular formula C24H27N3O
and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole |
| PubChem CID | 20523258 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | Cc1ccc2[nH]cc(CCCN3CCC(c4noc5ccccc45)CC3)c2c1 |
| InChI | InChI=1S/C24H27N3O/c1-17-8-9-22-21(15-17)19(16-25-22)5-4-12-27-13-10-18(11-14-27)24-20-6-2-3-7-23(20)28-26-24/h2-3,6-9,15-16,18,25H,4-5,10-14H2,1H3 |
| InChIKey | FVIRIGZISDFHGC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole?
The IUPAC name of 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole (CID 20523258) is 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole.
What is the SMILES notation for 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole?
The canonical SMILES for 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole is Cc1ccc2[nH]cc(CCCN3CCC(c4noc5ccccc45)CC3)c2c1.
What is the InChIKey of 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole?
The InChIKey is FVIRIGZISDFHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O/c1-17-8-9-22-21(15-17)19(16-25-22)5-4-12-27-13-10-18(11-14-27)24-20-6-2-3-7-23(20)28-26-24/h2-3,6-9,15-16,18,25H,4-5,10-14H2,1H3.
What are the key properties of 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole?
3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole has a molecular weight of 373.50 g/mol, XLogP of 5.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(5-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-1,2-benzoxazole is sourced from PubChem (CID 20523258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).