About 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione
2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 20523435) has the molecular formula C14H16BrNO2
and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 20523435 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(c2ccc(N)cc2Br)C(=O)C1 |
| InChI | InChI=1S/C14H16BrNO2/c1-14(2)6-11(17)13(12(18)7-14)9-4-3-8(16)5-10(9)15/h3-5,13H,6-7,16H2,1-2H3 |
| InChIKey | QGQIFTVTTNITCO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione (CID 20523435) is 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione is CC1(C)CC(=O)C(c2ccc(N)cc2Br)C(=O)C1.
What is the InChIKey of 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is QGQIFTVTTNITCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrNO2/c1-14(2)6-11(17)13(12(18)7-14)9-4-3-8(16)5-10(9)15/h3-5,13H,6-7,16H2,1-2H3.
What are the key properties of 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione?
2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 310.19 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-2-bromophenyl)-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 20523435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).