About 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride
6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride (PubChem CID 20523600) has the molecular formula C14H20ClN5O2
and a molecular weight of 325.80 g/mol. Its IUPAC name is 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride |
| PubChem CID | 20523600 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2nc(C3CNCCN3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C14H19N5O2.ClH/c1-20-11-5-8-9(6-12(11)21-2)18-14(19-13(8)15)10-7-16-3-4-17-10;/h5-6,10,16-17H,3-4,7H2,1-2H3,(H2,15,18,19);1H |
| InChIKey | HGGPTZHASIVARA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride?
The IUPAC name of 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride (CID 20523600) is 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride.
What is the SMILES notation for 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride?
The canonical SMILES for 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride is COc1cc2nc(C3CNCCN3)nc(N)c2cc1OC.Cl.
What is the InChIKey of 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride?
The InChIKey is HGGPTZHASIVARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2.ClH/c1-20-11-5-8-9(6-12(11)21-2)18-14(19-13(8)15)10-7-16-3-4-17-10;/h5-6,10,16-17H,3-4,7H2,1-2H3,(H2,15,18,19);1H.
What are the key properties of 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride?
6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride has a molecular weight of 325.80 g/mol, XLogP of 0.88, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-piperazin-2-ylquinazolin-4-amine;hydrochloride is sourced from PubChem (CID 20523600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).