C13H18N2O — CID 20523616
9-amino-1,2,3,5,6,6a,10a,10b-octahydrophenanthridin-1-ol (PubChem CID 20523616) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 9-amino-1,2,3,5,6,6a,10a,10b-octahydrophenanthridin-1-ol.
| Compound Name | 9-amino-1,2,3,5,6,6a,10a,10b-octahydrophenanthridin-1-ol |
|---|---|
| PubChem CID | 20523616 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 9-amino-1,2,3,5,6,6a,10a,10b-octahydrophenanthridin-1-ol |
| SMILES | NC1=CC2C(C=C1)CNC1=CCCC(O)C12 |
| InChI | InChI=1S/C13H18N2O/c14-9-5-4-8-7-15-11-2-1-3-12(16)13(11)10(8)6-9/h2,4-6,8,10,12-13,15-16H,1,3,7,14H2 |
| InChIKey | KZEZRHYCDDBWEF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |