C26H41N3O7 — CID 20523715
1-[2,2-bis[3-(2-methylprop-2-enoylamino)propoxy]ethyl-(2-methylprop-2-enoyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 20523715) has the molecular formula C26H41N3O7 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-[2,2-bis[3-(2-methylprop-2-enoylamino)propoxy]ethyl-(2-methylprop-2-enoyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[2,2-bis[3-(2-methylprop-2-enoylamino)propoxy]ethyl-(2-methylprop-2-enoyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20523715 |
| Molecular Formula | C26H41N3O7 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 1-[2,2-bis[3-(2-methylprop-2-enoylamino)propoxy]ethyl-(2-methylprop-2-enoyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)NCCCOC(CN(C(=O)C(=C)C)C(C)OC(=O)C(=C)C)OCCCNC(=O)C(=C)C |
| InChI | InChI=1S/C26H41N3O7/c1-17(2)23(30)27-12-10-14-34-22(35-15-11-13-28-24(31)18(3)4)16-29(25(32)19(5)6)21(9)36-26(33)20(7)8/h21-22H,1,3,5,7,10-16H2,2,4,6,8-9H3,(H,27,30)(H,28,31) |
| InChIKey | WKWCVSSKLBWZGP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|