About N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide
N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide (PubChem CID 20523776) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide.
Molecular Properties
| Compound Name | N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide |
| PubChem CID | 20523776 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide |
| SMILES | CC(C)NC(=O)C1=NCCCO1 |
| InChI | InChI=1S/C8H14N2O2/c1-6(2)10-7(11)8-9-4-3-5-12-8/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | SNJRXRHXFXULEL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide?
The IUPAC name of N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide (CID 20523776) is N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide.
What is the SMILES notation for N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide?
The canonical SMILES for N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide is CC(C)NC(=O)C1=NCCCO1.
What is the InChIKey of N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide?
The InChIKey is SNJRXRHXFXULEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6(2)10-7(11)8-9-4-3-5-12-8/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide?
N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide has a molecular weight of 170.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-5,6-dihydro-4H-1,3-oxazine-2-carboxamide is sourced from PubChem (CID 20523776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).