C12H18N2O2 — CID 20523840
N,N-bis(2-methylprop-2-enyl)-4,5-dihydro-1,3-oxazole-2-carboxamide (PubChem CID 20523840) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N,N-bis(2-methylprop-2-enyl)-4,5-dihydro-1,3-oxazole-2-carboxamide.
| Compound Name | N,N-bis(2-methylprop-2-enyl)-4,5-dihydro-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 20523840 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N,N-bis(2-methylprop-2-enyl)-4,5-dihydro-1,3-oxazole-2-carboxamide |
| SMILES | C=C(C)CN(CC(=C)C)C(=O)C1=NCCO1 |
| InChI | InChI=1S/C12H18N2O2/c1-9(2)7-14(8-10(3)4)12(15)11-13-5-6-16-11/h1,3,5-8H2,2,4H3 |
| InChIKey | WCUGCMFFSGNPDX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|