C22H34O5S — CID 20523974
5-[4-(4-carboxy-4-methylpentyl)sulfanyl-2,5-dimethylphenoxy]-2,2-dimethylpentanoic acid (PubChem CID 20523974) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is 5-[4-(4-carboxy-4-methylpentyl)sulfanyl-2,5-dimethylphenoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-(4-carboxy-4-methylpentyl)sulfanyl-2,5-dimethylphenoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 20523974 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[4-(4-carboxy-4-methylpentyl)sulfanyl-2,5-dimethylphenoxy]-2,2-dimethylpentanoic acid |
| SMILES | Cc1cc(SCCCC(C)(C)C(=O)O)c(C)cc1OCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H34O5S/c1-15-14-18(28-12-8-10-22(5,6)20(25)26)16(2)13-17(15)27-11-7-9-21(3,4)19(23)24/h13-14H,7-12H2,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | YDTRARRBHACXLO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|