C7H7Cl3F2O2 — CID 20523999
2-(2,2,3-trichloro-3,3-difluoropropyl)cyclopropane-1-carboxylic acid (PubChem CID 20523999) has the molecular formula C7H7Cl3F2O2 and a molecular weight of 267.49 g/mol. Its IUPAC name is 2-(2,2,3-trichloro-3,3-difluoropropyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-(2,2,3-trichloro-3,3-difluoropropyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 20523999 |
| Molecular Formula | C7H7Cl3F2O2 |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 2-(2,2,3-trichloro-3,3-difluoropropyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1CC(Cl)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C7H7Cl3F2O2/c8-6(9,7(10,11)12)2-3-1-4(3)5(13)14/h3-4H,1-2H2,(H,13,14) |
| InChIKey | UDEKPECNBQYQPL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|