C4H5N3O4S3 — CID 20524197
2-oxo-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]ethanesulfonic acid (PubChem CID 20524197) has the molecular formula C4H5N3O4S3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-oxo-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]ethanesulfonic acid.
| Compound Name | 2-oxo-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 20524197 |
| Molecular Formula | C4H5N3O4S3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 2-oxo-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]ethanesulfonic acid |
| SMILES | O=C(CS(=O)(=O)O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C4H5N3O4S3/c8-2(1-14(9,10)11)5-3-6-7-4(12)13-3/h1H2,(H,7,12)(H,5,6,8)(H,9,10,11) |
| InChIKey | LBADUTLJPPQLEQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|