About 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one
4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one (PubChem CID 20524296) has the molecular formula C9H5Cl3FN3OS
and a molecular weight of 328.58 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one |
| PubChem CID | 20524296 |
| Molecular Formula | C9H5Cl3FN3OS |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one |
| SMILES | O=c1n(-c2ccccc2Cl)cnn1SC(F)(Cl)Cl |
| InChI | InChI=1S/C9H5Cl3FN3OS/c10-6-3-1-2-4-7(6)15-5-14-16(8(15)17)18-9(11,12)13/h1-5H |
| InChIKey | MLCIEYPLVBQODI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one?
The IUPAC name of 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one (CID 20524296) is 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one.
What is the SMILES notation for 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one?
The canonical SMILES for 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one is O=c1n(-c2ccccc2Cl)cnn1SC(F)(Cl)Cl.
What is the InChIKey of 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one?
The InChIKey is MLCIEYPLVBQODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl3FN3OS/c10-6-3-1-2-4-7(6)15-5-14-16(8(15)17)18-9(11,12)13/h1-5H.
What are the key properties of 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one?
4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one has a molecular weight of 328.58 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-2-[dichloro(fluoro)methyl]sulfanyl-1,2,4-triazol-3-one is sourced from PubChem (CID 20524296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).