About 1-sulfinyl-1,3-benzothiazole
1-sulfinyl-1,3-benzothiazole (PubChem CID 20524673) has the molecular formula C7H5NOS2
and a molecular weight of 183.26 g/mol. Its IUPAC name is 1-sulfinyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 1-sulfinyl-1,3-benzothiazole |
| PubChem CID | 20524673 |
| Molecular Formula | C7H5NOS2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 182.98 |
| IUPAC Name | 1-sulfinyl-1,3-benzothiazole |
| SMILES | O=S=S1C=Nc2ccccc21 |
| InChI | InChI=1S/C7H5NOS2/c9-10-11-5-8-6-3-1-2-4-7(6)11/h1-5H |
| InChIKey | XHUKEVQWUVSRDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-sulfinyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfinyl-1,3-benzothiazole?
The IUPAC name of 1-sulfinyl-1,3-benzothiazole (CID 20524673) is 1-sulfinyl-1,3-benzothiazole.
What is the SMILES notation for 1-sulfinyl-1,3-benzothiazole?
The canonical SMILES for 1-sulfinyl-1,3-benzothiazole is O=S=S1C=Nc2ccccc21.
What is the InChIKey of 1-sulfinyl-1,3-benzothiazole?
The InChIKey is XHUKEVQWUVSRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS2/c9-10-11-5-8-6-3-1-2-4-7(6)11/h1-5H.
What are the key properties of 1-sulfinyl-1,3-benzothiazole?
1-sulfinyl-1,3-benzothiazole has a molecular weight of 183.26 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfinyl-1,3-benzothiazole is sourced from PubChem (CID 20524673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).