About 5-methyl-4,7-dioxonon-8-enoic acid
5-methyl-4,7-dioxonon-8-enoic acid (PubChem CID 20524800) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-methyl-4,7-dioxonon-8-enoic acid.
Molecular Properties
| Compound Name | 5-methyl-4,7-dioxonon-8-enoic acid |
| PubChem CID | 20524800 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-methyl-4,7-dioxonon-8-enoic acid |
| SMILES | C=CC(=O)CC(C)C(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14O4/c1-3-8(11)6-7(2)9(12)4-5-10(13)14/h3,7H,1,4-6H2,2H3,(H,13,14) |
| InChIKey | YPIBAXBAWHPZPS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4,7-dioxonon-8-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,7-dioxonon-8-enoic acid?
The IUPAC name of 5-methyl-4,7-dioxonon-8-enoic acid (CID 20524800) is 5-methyl-4,7-dioxonon-8-enoic acid.
What is the SMILES notation for 5-methyl-4,7-dioxonon-8-enoic acid?
The canonical SMILES for 5-methyl-4,7-dioxonon-8-enoic acid is C=CC(=O)CC(C)C(=O)CCC(=O)O.
What is the InChIKey of 5-methyl-4,7-dioxonon-8-enoic acid?
The InChIKey is YPIBAXBAWHPZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-8(11)6-7(2)9(12)4-5-10(13)14/h3,7H,1,4-6H2,2H3,(H,13,14).
What are the key properties of 5-methyl-4,7-dioxonon-8-enoic acid?
5-methyl-4,7-dioxonon-8-enoic acid has a molecular weight of 198.22 g/mol, XLogP of 1.20, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,7-dioxonon-8-enoic acid is sourced from PubChem (CID 20524800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).