C14H17FN4O5 — CID 20525065
N-[5-(2,5-dioxopyrrolidin-1-yl)pentyl]-5-fluoro-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 20525065) has the molecular formula C14H17FN4O5 and a molecular weight of 340.31 g/mol. Its IUPAC name is N-[5-(2,5-dioxopyrrolidin-1-yl)pentyl]-5-fluoro-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | N-[5-(2,5-dioxopyrrolidin-1-yl)pentyl]-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 20525065 |
| Molecular Formula | C14H17FN4O5 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[5-(2,5-dioxopyrrolidin-1-yl)pentyl]-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | O=C1CCC(=O)N1CCCCCNC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H17FN4O5/c15-9-8-19(14(24)17-12(9)22)13(23)16-6-2-1-3-7-18-10(20)4-5-11(18)21/h8H,1-7H2,(H,16,23)(H,17,22,24) |
| InChIKey | XTMWRPSHCTUVLS-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|