C10H10FN3O3 — CID 20525069
5-fluoro-2,4-dioxo-N-[(1E,3E)-penta-1,3-dienyl]pyrimidine-1-carboxamide (PubChem CID 20525069) has the molecular formula C10H10FN3O3 and a molecular weight of 239.21 g/mol. Its IUPAC name is 5-fluoro-2,4-dioxo-N-[(1E,3E)-penta-1,3-dienyl]pyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-2,4-dioxo-N-[(1E,3E)-penta-1,3-dienyl]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 20525069 |
| Molecular Formula | C10H10FN3O3 |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 5-fluoro-2,4-dioxo-N-[(1E,3E)-penta-1,3-dienyl]pyrimidine-1-carboxamide |
| SMILES | C/C=C/C=C/NC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10FN3O3/c1-2-3-4-5-12-9(16)14-6-7(11)8(15)13-10(14)17/h2-6H,1H3,(H,12,16)(H,13,15,17)/b3-2+,5-4+ |
| InChIKey | DNPWNXRLJUDVGU-MQQKCMAXSA-N |
| XLogP | 0.32 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|