C29H19BrN2O3S2 — CID 20525276
5-[(4-bromophenyl)-phenylmethylidene]-1,3-bis(phenylsulfanyl)-1,3-diazinane-2,4,6-trione (PubChem CID 20525276) has the molecular formula C29H19BrN2O3S2 and a molecular weight of 587.52 g/mol. Its IUPAC name is 5-[(4-bromophenyl)-phenylmethylidene]-1,3-bis(phenylsulfanyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-bromophenyl)-phenylmethylidene]-1,3-bis(phenylsulfanyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20525276 |
| Molecular Formula | C29H19BrN2O3S2 |
| Molecular Weight | 587.52 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 5-[(4-bromophenyl)-phenylmethylidene]-1,3-bis(phenylsulfanyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=C(c2ccccc2)c2ccc(Br)cc2)C(=O)N(Sc2ccccc2)C(=O)N1Sc1ccccc1 |
| InChI | InChI=1S/C29H19BrN2O3S2/c30-22-18-16-21(17-19-22)25(20-10-4-1-5-11-20)26-27(33)31(36-23-12-6-2-7-13-23)29(35)32(28(26)34)37-24-14-8-3-9-15-24/h1-19H |
| InChIKey | XHBLVENEJLWWKB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|