About 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one
4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one (PubChem CID 20525378) has the molecular formula C30H26Cl2N2O2
and a molecular weight of 517.46 g/mol. Its IUPAC name is 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one |
| PubChem CID | 20525378 |
| Molecular Formula | C30H26Cl2N2O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CCn1c(C)c(C2(c3c(C)n(CC)c4ccccc34)OC(=O)c3c(Cl)ccc(Cl)c32)c2ccccc21 |
| InChI | InChI=1S/C30H26Cl2N2O2/c1-5-33-17(3)26(19-11-7-9-13-23(19)33)30(28-22(32)16-15-21(31)25(28)29(35)36-30)27-18(4)34(6-2)24-14-10-8-12-20(24)27/h7-16H,5-6H2,1-4H3 |
| InChIKey | CVUGZAXZWJPNRK-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one?
The IUPAC name of 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one (CID 20525378) is 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one.
What is the SMILES notation for 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one?
The canonical SMILES for 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one is CCn1c(C)c(C2(c3c(C)n(CC)c4ccccc34)OC(=O)c3c(Cl)ccc(Cl)c32)c2ccccc21.
What is the InChIKey of 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one?
The InChIKey is CVUGZAXZWJPNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26Cl2N2O2/c1-5-33-17(3)26(19-11-7-9-13-23(19)33)30(28-22(32)16-15-21(31)25(28)29(35)36-30)27-18(4)34(6-2)24-14-10-8-12-20(24)27/h7-16H,5-6H2,1-4H3.
What are the key properties of 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one?
4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one has a molecular weight of 517.46 g/mol, XLogP of 8.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dichloro-3,3-bis(1-ethyl-2-methylindol-3-yl)-2-benzofuran-1-one is sourced from PubChem (CID 20525378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).