About 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one
5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one (PubChem CID 20525380) has the molecular formula C24H22Cl2N2O2
and a molecular weight of 441.36 g/mol. Its IUPAC name is 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one |
| PubChem CID | 20525380 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)OC(=O)c3cc(Cl)c(Cl)cc32)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O2/c1-27(2)17-9-5-15(6-10-17)24(16-7-11-18(12-8-16)28(3)4)20-14-22(26)21(25)13-19(20)23(29)30-24/h5-14H,1-4H3 |
| InChIKey | BTOGSARPPWJXNM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one?
The IUPAC name of 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one (CID 20525380) is 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one.
What is the SMILES notation for 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one?
The canonical SMILES for 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one is CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)OC(=O)c3cc(Cl)c(Cl)cc32)cc1.
What is the InChIKey of 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one?
The InChIKey is BTOGSARPPWJXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2O2/c1-27(2)17-9-5-15(6-10-17)24(16-7-11-18(12-8-16)28(3)4)20-14-22(26)21(25)13-19(20)23(29)30-24/h5-14H,1-4H3.
What are the key properties of 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one?
5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one has a molecular weight of 441.36 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one is sourced from PubChem (CID 20525380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).