C16H8ClF3N2O3S — CID 20525629
6-(2-chlorophenyl)-3-[2-sulfanyl-4-(trifluoromethyl)phenyl]-1,3,5-oxadiazine-2,4-dione (PubChem CID 20525629) has the molecular formula C16H8ClF3N2O3S and a molecular weight of 400.77 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3-[2-sulfanyl-4-(trifluoromethyl)phenyl]-1,3,5-oxadiazine-2,4-dione.
| Compound Name | 6-(2-chlorophenyl)-3-[2-sulfanyl-4-(trifluoromethyl)phenyl]-1,3,5-oxadiazine-2,4-dione |
|---|---|
| PubChem CID | 20525629 |
| Molecular Formula | C16H8ClF3N2O3S |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 6-(2-chlorophenyl)-3-[2-sulfanyl-4-(trifluoromethyl)phenyl]-1,3,5-oxadiazine-2,4-dione |
| SMILES | O=c1nc(-c2ccccc2Cl)oc(=O)n1-c1ccc(C(F)(F)F)cc1S |
| InChI | InChI=1S/C16H8ClF3N2O3S/c17-10-4-2-1-3-9(10)13-21-14(23)22(15(24)25-13)11-6-5-8(7-12(11)26)16(18,19)20/h1-7,26H |
| InChIKey | DUCDHMVIYHLKAL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|