C23H39N7O3 — CID 20526073
ethyl (2E)-2-[[4-[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-6-piperidin-1-yl-1,3,5-triazin-2-yl]imino]acetate (PubChem CID 20526073) has the molecular formula C23H39N7O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is ethyl (2E)-2-[[4-[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-6-piperidin-1-yl-1,3,5-triazin-2-yl]imino]acetate.
| Compound Name | ethyl (2E)-2-[[4-[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-6-piperidin-1-yl-1,3,5-triazin-2-yl]imino]acetate |
|---|---|
| PubChem CID | 20526073 |
| Molecular Formula | C23H39N7O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | ethyl (2E)-2-[[4-[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-6-piperidin-1-yl-1,3,5-triazin-2-yl]imino]acetate |
| SMILES | CCOC(=O)/C=N/c1nc(NC2CC(C)(C)N(CCO)C(C)(C)C2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H39N7O3/c1-6-33-18(32)16-24-19-26-20(28-21(27-19)29-10-8-7-9-11-29)25-17-14-22(2,3)30(12-13-31)23(4,5)15-17/h16-17,31H,6-15H2,1-5H3,(H,25,26,27,28)/b24-16+ |
| InChIKey | AGNXEDMEENSRAQ-LFVJCYFKSA-N |
| XLogP | 2.55 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|