C13H10Cl6N12 — CID 20526076
N,N'-bis(4,6-dichloro-1,3,5-triazin-2-yl)-N'-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]ethane-1,2-diamine (PubChem CID 20526076) has the molecular formula C13H10Cl6N12 and a molecular weight of 547.03 g/mol. Its IUPAC name is N,N'-bis(4,6-dichloro-1,3,5-triazin-2-yl)-N'-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis(4,6-dichloro-1,3,5-triazin-2-yl)-N'-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 20526076 |
| Molecular Formula | C13H10Cl6N12 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | N,N'-bis(4,6-dichloro-1,3,5-triazin-2-yl)-N'-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]ethane-1,2-diamine |
| SMILES | Clc1nc(Cl)nc(NCCN(CCNc2nc(Cl)nc(Cl)n2)c2nc(Cl)nc(Cl)n2)n1 |
| InChI | InChI=1S/C13H10Cl6N12/c14-5-22-6(15)26-11(25-5)20-1-3-31(13-29-9(18)24-10(19)30-13)4-2-21-12-27-7(16)23-8(17)28-12/h1-4H2,(H,20,22,25,26)(H,21,23,27,28) |
| InChIKey | AQTOLCUAIPWMHR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |