About 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol
4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol (PubChem CID 20527198) has the molecular formula C20H22ClN3O4S2
and a molecular weight of 468.00 g/mol. Its IUPAC name is 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol |
| PubChem CID | 20527198 |
| Molecular Formula | C20H22ClN3O4S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol |
| SMILES | CN1/C(=N/c2ccccc2)SCC1(O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H22ClN3O4S2/c1-23-19(22-16-5-3-2-4-6-16)29-14-20(23,25)15-7-8-17(21)18(13-15)30(26,27)24-9-11-28-12-10-24/h2-8,13,25H,9-12,14H2,1H3/b22-19- |
| InChIKey | UCNVRCKSAPCAOD-QOCHGBHMSA-N |
| XLogP | 2.87 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol?
The IUPAC name of 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol (CID 20527198) is 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol.
What is the SMILES notation for 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol?
The canonical SMILES for 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol is CN1/C(=N/c2ccccc2)SCC1(O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol?
The InChIKey is UCNVRCKSAPCAOD-QOCHGBHMSA-N. The full InChI is InChI=1S/C20H22ClN3O4S2/c1-23-19(22-16-5-3-2-4-6-16)29-14-20(23,25)15-7-8-17(21)18(13-15)30(26,27)24-9-11-28-12-10-24/h2-8,13,25H,9-12,14H2,1H3/b22-19-.
What are the key properties of 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol?
4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol has a molecular weight of 468.00 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-methyl-2-phenylimino-1,3-thiazolidin-4-ol is sourced from PubChem (CID 20527198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).