C23H26ClN3O2S2 — CID 20527310
4-[4-chloro-3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-methyl-N-phenyl-1,3-thiazol-2-imine (PubChem CID 20527310) has the molecular formula C23H26ClN3O2S2 and a molecular weight of 476.07 g/mol. Its IUPAC name is 4-[4-chloro-3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-methyl-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-chloro-3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-methyl-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 20527310 |
| Molecular Formula | C23H26ClN3O2S2 |
| Molecular Weight | 476.07 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-[4-chloro-3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-methyl-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cc(-c3cs/c(=N\c4ccccc4)n3C)ccc2Cl)C1 |
| InChI | InChI=1S/C23H26ClN3O2S2/c1-16-11-17(2)14-27(13-16)31(28,29)22-12-18(9-10-20(22)24)21-15-30-23(26(21)3)25-19-7-5-4-6-8-19/h4-10,12,15-17H,11,13-14H2,1-3H3/b25-23- |
| InChIKey | QXQILDMUWBUPTN-BZZOAKBMSA-N |
| XLogP | 5.31 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|