C19H20ClN3O5S2 — CID 20527337
2-chloro-5-[3-methyl-2-(3,4,5-trimethoxyphenyl)imino-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 20527337) has the molecular formula C19H20ClN3O5S2 and a molecular weight of 469.97 g/mol. Its IUPAC name is 2-chloro-5-[3-methyl-2-(3,4,5-trimethoxyphenyl)imino-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | 2-chloro-5-[3-methyl-2-(3,4,5-trimethoxyphenyl)imino-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20527337 |
| Molecular Formula | C19H20ClN3O5S2 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-chloro-5-[3-methyl-2-(3,4,5-trimethoxyphenyl)imino-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | COc1cc(/N=c2\scc(-c3ccc(Cl)c(S(N)(=O)=O)c3)n2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H20ClN3O5S2/c1-23-14(11-5-6-13(20)17(7-11)30(21,24)25)10-29-19(23)22-12-8-15(26-2)18(28-4)16(9-12)27-3/h5-10H,1-4H3,(H2,21,24,25)/b22-19- |
| InChIKey | ZCFKBCLWSQKHGG-QOCHGBHMSA-N |
| XLogP | 3.31 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|