C17H13ClO2 — CID 20527496
(2E)-2-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)acetic acid (PubChem CID 20527496) has the molecular formula C17H13ClO2 and a molecular weight of 284.74 g/mol. Its IUPAC name is (2E)-2-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)acetic acid.
| Compound Name | (2E)-2-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)acetic acid |
|---|---|
| PubChem CID | 20527496 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2E)-2-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)acetic acid |
| SMILES | O=C(O)/C=C1\c2ccccc2CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H13ClO2/c18-13-7-8-15-12(9-13)6-5-11-3-1-2-4-14(11)16(15)10-17(19)20/h1-4,7-10H,5-6H2,(H,19,20)/b16-10+ |
| InChIKey | FZGXWBDVNAMTFQ-MHWRWJLKSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|