About N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide
N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 20527630) has the molecular formula C21H29F3N2O3
and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 20527630 |
| Molecular Formula | C21H29F3N2O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)C1(CNC(=O)c2ccc(C(F)(F)F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C21H29F3N2O3/c1-3-26(4-2)19(9-11-20(12-10-19)28-13-14-29-20)15-25-18(27)16-5-7-17(8-6-16)21(22,23)24/h5-8H,3-4,9-15H2,1-2H3,(H,25,27) |
| InChIKey | YKXSYWCDZWOHMH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide?
The IUPAC name of N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide (CID 20527630) is N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide is CCN(CC)C1(CNC(=O)c2ccc(C(F)(F)F)cc2)CCC2(CC1)OCCO2.
What is the InChIKey of N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide?
The InChIKey is YKXSYWCDZWOHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29F3N2O3/c1-3-26(4-2)19(9-11-20(12-10-19)28-13-14-29-20)15-25-18(27)16-5-7-17(8-6-16)21(22,23)24/h5-8H,3-4,9-15H2,1-2H3,(H,25,27).
What are the key properties of N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide?
N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide has a molecular weight of 414.47 g/mol, XLogP of 3.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[8-(diethylamino)-1,4-dioxaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 20527630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).