C22H19N3O8S — CID 20527715
(4-nitrophenyl)methyl 3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 20527715) has the molecular formula C22H19N3O8S and a molecular weight of 485.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 20527715 |
| Molecular Formula | C22H19N3O8S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (4-nitrophenyl)methyl 3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)C(=O)CSC12 |
| InChI | InChI=1S/C22H19N3O8S/c26-16-12-34-21-18(23-17(27)11-32-15-4-2-1-3-5-15)20(28)24(21)19(16)22(29)33-10-13-6-8-14(9-7-13)25(30)31/h1-9,18-19,21H,10-12H2,(H,23,27) |
| InChIKey | VQFGWYHMMWPTFB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|