About 3,6-diisocyanato-3,6-dimethyloctane
3,6-diisocyanato-3,6-dimethyloctane (PubChem CID 20528064) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 3,6-diisocyanato-3,6-dimethyloctane.
Molecular Properties
| Compound Name | 3,6-diisocyanato-3,6-dimethyloctane |
| PubChem CID | 20528064 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3,6-diisocyanato-3,6-dimethyloctane |
| SMILES | CCC(C)(CCC(C)(CC)N=C=O)N=C=O |
| InChI | InChI=1S/C12H20N2O2/c1-5-11(3,13-9-15)7-8-12(4,6-2)14-10-16/h5-8H2,1-4H3 |
| InChIKey | LJBSXNWMBYWWRH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diisocyanato-3,6-dimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diisocyanato-3,6-dimethyloctane?
The IUPAC name of 3,6-diisocyanato-3,6-dimethyloctane (CID 20528064) is 3,6-diisocyanato-3,6-dimethyloctane.
What is the SMILES notation for 3,6-diisocyanato-3,6-dimethyloctane?
The canonical SMILES for 3,6-diisocyanato-3,6-dimethyloctane is CCC(C)(CCC(C)(CC)N=C=O)N=C=O.
What is the InChIKey of 3,6-diisocyanato-3,6-dimethyloctane?
The InChIKey is LJBSXNWMBYWWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-5-11(3,13-9-15)7-8-12(4,6-2)14-10-16/h5-8H2,1-4H3.
What are the key properties of 3,6-diisocyanato-3,6-dimethyloctane?
3,6-diisocyanato-3,6-dimethyloctane has a molecular weight of 224.30 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diisocyanato-3,6-dimethyloctane is sourced from PubChem (CID 20528064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).