About 4-aminothiolan-3-one
4-aminothiolan-3-one (PubChem CID 20528374) has the molecular formula C4H7NOS
and a molecular weight of 117.17 g/mol. Its IUPAC name is 4-aminothiolan-3-one.
Molecular Properties
| Compound Name | 4-aminothiolan-3-one |
| PubChem CID | 20528374 |
| Molecular Formula | C4H7NOS |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | 4-aminothiolan-3-one |
| SMILES | NC1CSCC1=O |
| InChI | InChI=1S/C4H7NOS/c5-3-1-7-2-4(3)6/h3H,1-2,5H2 |
| InChIKey | ZPZCGXUJKYTBDW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminothiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminothiolan-3-one?
The IUPAC name of 4-aminothiolan-3-one (CID 20528374) is 4-aminothiolan-3-one.
What is the SMILES notation for 4-aminothiolan-3-one?
The canonical SMILES for 4-aminothiolan-3-one is NC1CSCC1=O.
What is the InChIKey of 4-aminothiolan-3-one?
The InChIKey is ZPZCGXUJKYTBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS/c5-3-1-7-2-4(3)6/h3H,1-2,5H2.
What are the key properties of 4-aminothiolan-3-one?
4-aminothiolan-3-one has a molecular weight of 117.17 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminothiolan-3-one is sourced from PubChem (CID 20528374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).