About N,N,5-trimethylcyclohexa-1,5-dien-1-amine
N,N,5-trimethylcyclohexa-1,5-dien-1-amine (PubChem CID 20528984) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is N,N,5-trimethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N,N,5-trimethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 20528984 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N,N,5-trimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CC(N(C)C)=CCC1 |
| InChI | InChI=1S/C9H15N/c1-8-5-4-6-9(7-8)10(2)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | XUBLRKYXSCWCNJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N,5-trimethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,5-trimethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N,N,5-trimethylcyclohexa-1,5-dien-1-amine (CID 20528984) is N,N,5-trimethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N,N,5-trimethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N,N,5-trimethylcyclohexa-1,5-dien-1-amine is CC1=CC(N(C)C)=CCC1.
What is the InChIKey of N,N,5-trimethylcyclohexa-1,5-dien-1-amine?
The InChIKey is XUBLRKYXSCWCNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-8-5-4-6-9(7-8)10(2)3/h6-7H,4-5H2,1-3H3.
What are the key properties of N,N,5-trimethylcyclohexa-1,5-dien-1-amine?
N,N,5-trimethylcyclohexa-1,5-dien-1-amine has a molecular weight of 137.23 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,5-trimethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 20528984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).