About 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid
2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid (PubChem CID 20529195) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid |
| PubChem CID | 20529195 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid |
| SMILES | Cc1ccc(-c2c(C)n(C)c3ccc(OC(C)(C)C(=O)O)cc23)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-13-6-8-15(9-7-13)19-14(2)22(5)18-11-10-16(12-17(18)19)25-21(3,4)20(23)24/h6-12H,1-5H3,(H,23,24) |
| InChIKey | SAUWOZXIYMIXIT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid?
The IUPAC name of 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid (CID 20529195) is 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid.
What is the SMILES notation for 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid?
The canonical SMILES for 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid is Cc1ccc(-c2c(C)n(C)c3ccc(OC(C)(C)C(=O)O)cc23)cc1.
What is the InChIKey of 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid?
The InChIKey is SAUWOZXIYMIXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-13-6-8-15(9-7-13)19-14(2)22(5)18-11-10-16(12-17(18)19)25-21(3,4)20(23)24/h6-12H,1-5H3,(H,23,24).
What are the key properties of 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid?
2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid has a molecular weight of 337.42 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,2-dimethyl-3-(4-methylphenyl)indol-5-yl]oxy-2-methylpropanoic acid is sourced from PubChem (CID 20529195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).