C19H16F3NO5 — CID 20529925
7,8-dihydroxy-5-phenyl-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepine-9-carboxylic acid (PubChem CID 20529925) has the molecular formula C19H16F3NO5 and a molecular weight of 395.33 g/mol. Its IUPAC name is 7,8-dihydroxy-5-phenyl-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepine-9-carboxylic acid.
| Compound Name | 7,8-dihydroxy-5-phenyl-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepine-9-carboxylic acid |
|---|---|
| PubChem CID | 20529925 |
| Molecular Formula | C19H16F3NO5 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 7,8-dihydroxy-5-phenyl-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepine-9-carboxylic acid |
| SMILES | O=C(O)c1c(O)c(O)cc2c1CCN(C(=O)C(F)(F)F)CC2c1ccccc1 |
| InChI | InChI=1S/C19H16F3NO5/c20-19(21,22)18(28)23-7-6-11-12(8-14(24)16(25)15(11)17(26)27)13(9-23)10-4-2-1-3-5-10/h1-5,8,13,24-25H,6-7,9H2,(H,26,27) |
| InChIKey | LIPROJZWDNHMGL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|