C18H21NO2 — CID 20529930
9-ethyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol (PubChem CID 20529930) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 9-ethyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol.
| Compound Name | 9-ethyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 20529930 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 9-ethyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| SMILES | CCc1c(O)c(O)cc2c1CCNCC2c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-2-13-14-8-9-19-11-16(12-6-4-3-5-7-12)15(14)10-17(20)18(13)21/h3-7,10,16,19-21H,2,8-9,11H2,1H3 |
| InChIKey | HACYSRNZYRTVIZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|