C13H20F3N7S — CID 20530332
1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 20530332) has the molecular formula C13H20F3N7S and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 20530332 |
| Molecular Formula | C13H20F3N7S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | NC(N)=Nc1nc(C2CCCC(N/C(N)=N/CC(F)(F)F)C2)cs1 |
| InChI | InChI=1S/C13H20F3N7S/c14-13(15,16)6-20-11(19)21-8-3-1-2-7(4-8)9-5-24-12(22-9)23-10(17)18/h5,7-8H,1-4,6H2,(H3,19,20,21)(H4,17,18,22,23) |
| InChIKey | SODNDLQEWUONJX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|