C13H19F3N6OS — CID 20530389
1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 20530389) has the molecular formula C13H19F3N6OS and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 20530389 |
| Molecular Formula | C13H19F3N6OS |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | NC(N)=Nc1nc(C2CCCC(NC(=O)NCC(F)(F)F)C2)cs1 |
| InChI | InChI=1S/C13H19F3N6OS/c14-13(15,16)6-19-11(23)20-8-3-1-2-7(4-8)9-5-24-12(21-9)22-10(17)18/h5,7-8H,1-4,6H2,(H2,19,20,23)(H4,17,18,21,22) |
| InChIKey | WKQAJTKINPFPMO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|