C14H22N4O4 — CID 20530787
1-[4-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)butyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 20530787) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-[4-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)butyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[4-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)butyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 20530787 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-[4-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)butyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1CCCCN1C(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H22N4O4/c1-13(2)9(19)15-11(21)17(13)7-5-6-8-18-12(22)16-10(20)14(18,3)4/h5-8H2,1-4H3,(H,15,19,21)(H,16,20,22) |
| InChIKey | BFUOXYCGQCINOE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|