C11H8Cl2F4O — CID 20531317
4-(1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 20531317) has the molecular formula C11H8Cl2F4O and a molecular weight of 303.08 g/mol. Its IUPAC name is 4-(1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-(1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20531317 |
| Molecular Formula | C11H8Cl2F4O |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 4-(1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=C(C(F)(F)Cl)C(F)(F)Cl)C=C(C)C1=O |
| InChI | InChI=1S/C11H8Cl2F4O/c1-5-3-7(4-6(2)8(5)18)9(10(12,14)15)11(13,16)17/h3-4H,1-2H3 |
| InChIKey | PTGJYKMIWPSGKK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|