C21H18ClNO6S — CID 20531388
[4-[2,6-bis(furan-2-yl)thiopyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 20531388) has the molecular formula C21H18ClNO6S and a molecular weight of 447.90 g/mol. Its IUPAC name is [4-[2,6-bis(furan-2-yl)thiopyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-[2,6-bis(furan-2-yl)thiopyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 20531388 |
| Molecular Formula | C21H18ClNO6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | [4-[2,6-bis(furan-2-yl)thiopyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | C[N+](C)=C1C=CC(=C2C=C(c3ccco3)SC(c3ccco3)=C2)C=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H18NO2S.ClHO4/c1-22(2)17-9-7-15(8-10-17)16-13-20(18-5-3-11-23-18)25-21(14-16)19-6-4-12-24-19;2-1(3,4)5/h3-14H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ACYQIDJUJJUWKU-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 121.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|