About [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium
[5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium (PubChem CID 20531391) has the molecular formula C24H21N2S+
and a molecular weight of 369.51 g/mol. Its IUPAC name is [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium.
Molecular Properties
| Compound Name | [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium |
| PubChem CID | 20531391 |
| Molecular Formula | C24H21N2S+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=C2C=C(c3ccccc3)SC(c3ccccc3)=C2)C=N1 |
| InChI | InChI=1S/C24H21N2S/c1-26(2)24-14-13-20(17-25-24)21-15-22(18-9-5-3-6-10-18)27-23(16-21)19-11-7-4-8-12-19/h3-17H,1-2H3/q+1 |
| InChIKey | NYYVPBWQUKHDGS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium?
The IUPAC name of [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium (CID 20531391) is [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium.
What is the SMILES notation for [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium?
The canonical SMILES for [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium is C[N+](C)=C1C=CC(=C2C=C(c3ccccc3)SC(c3ccccc3)=C2)C=N1.
What is the InChIKey of [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium?
The InChIKey is NYYVPBWQUKHDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N2S/c1-26(2)24-14-13-20(17-25-24)21-15-22(18-9-5-3-6-10-18)27-23(16-21)19-11-7-4-8-12-19/h3-17H,1-2H3/q+1.
What are the key properties of [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium?
[5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium has a molecular weight of 369.51 g/mol, XLogP of 5.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,6-diphenylthiopyran-4-ylidene)-2-pyridinylidene]-dimethylazanium is sourced from PubChem (CID 20531391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).