About 6-methoxy-3,7-dimethyloct-7-en-1-ol
6-methoxy-3,7-dimethyloct-7-en-1-ol (PubChem CID 20531628) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 6-methoxy-3,7-dimethyloct-7-en-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-3,7-dimethyloct-7-en-1-ol |
| PubChem CID | 20531628 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 6-methoxy-3,7-dimethyloct-7-en-1-ol |
| SMILES | C=C(C)C(CCC(C)CCO)OC |
| InChI | InChI=1S/C11H22O2/c1-9(2)11(13-4)6-5-10(3)7-8-12/h10-12H,1,5-8H2,2-4H3 |
| InChIKey | VKRQXMQEPSPVAG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-3,7-dimethyloct-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,7-dimethyloct-7-en-1-ol?
The IUPAC name of 6-methoxy-3,7-dimethyloct-7-en-1-ol (CID 20531628) is 6-methoxy-3,7-dimethyloct-7-en-1-ol.
What is the SMILES notation for 6-methoxy-3,7-dimethyloct-7-en-1-ol?
The canonical SMILES for 6-methoxy-3,7-dimethyloct-7-en-1-ol is C=C(C)C(CCC(C)CCO)OC.
What is the InChIKey of 6-methoxy-3,7-dimethyloct-7-en-1-ol?
The InChIKey is VKRQXMQEPSPVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-9(2)11(13-4)6-5-10(3)7-8-12/h10-12H,1,5-8H2,2-4H3.
What are the key properties of 6-methoxy-3,7-dimethyloct-7-en-1-ol?
6-methoxy-3,7-dimethyloct-7-en-1-ol has a molecular weight of 186.29 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,7-dimethyloct-7-en-1-ol is sourced from PubChem (CID 20531628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).