C19H30N2O3 — CID 20531652
6-(2-amino-2-hydroxy-5,6-dimethylheptoxy)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 20531652) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6-(2-amino-2-hydroxy-5,6-dimethylheptoxy)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 6-(2-amino-2-hydroxy-5,6-dimethylheptoxy)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 20531652 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 6-(2-amino-2-hydroxy-5,6-dimethylheptoxy)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CC(C)C(C)CCC(N)(O)COc1cccc2c1CCCC(=O)N2 |
| InChI | InChI=1S/C19H30N2O3/c1-13(2)14(3)10-11-19(20,23)12-24-17-8-5-7-16-15(17)6-4-9-18(22)21-16/h5,7-8,13-14,23H,4,6,9-12,20H2,1-3H3,(H,21,22) |
| InChIKey | QLTASQPJZYMHIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|