About 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol
4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol (PubChem CID 20531716) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol |
| PubChem CID | 20531716 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol |
| SMILES | CCCN1Cc2c(O)cccc2C(c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C18H21NO3/c1-2-8-19-10-14(12-6-7-17(21)18(22)9-12)13-4-3-5-16(20)15(13)11-19/h3-7,9,14,20-22H,2,8,10-11H2,1H3 |
| InChIKey | JECTVFRGHSLBRG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol?
The IUPAC name of 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol (CID 20531716) is 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol.
What is the SMILES notation for 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol?
The canonical SMILES for 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol is CCCN1Cc2c(O)cccc2C(c2ccc(O)c(O)c2)C1.
What is the InChIKey of 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol?
The InChIKey is JECTVFRGHSLBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c1-2-8-19-10-14(12-6-7-17(21)18(22)9-12)13-4-3-5-16(20)15(13)11-19/h3-7,9,14,20-22H,2,8,10-11H2,1H3.
What are the key properties of 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol?
4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol has a molecular weight of 299.37 g/mol, XLogP of 3.16, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-hydroxy-2-propyl-3,4-dihydro-1H-isoquinolin-4-yl)benzene-1,2-diol is sourced from PubChem (CID 20531716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).