About 2-N-(oxomethylidene)benzene-1,2-disulfonamide
2-N-(oxomethylidene)benzene-1,2-disulfonamide (PubChem CID 20532150) has the molecular formula C7H6N2O5S2
and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-N-(oxomethylidene)benzene-1,2-disulfonamide.
Molecular Properties
| Compound Name | 2-N-(oxomethylidene)benzene-1,2-disulfonamide |
| PubChem CID | 20532150 |
| Molecular Formula | C7H6N2O5S2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 2-N-(oxomethylidene)benzene-1,2-disulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1S(=O)(=O)N=C=O |
| InChI | InChI=1S/C7H6N2O5S2/c8-15(11,12)6-3-1-2-4-7(6)16(13,14)9-5-10/h1-4H,(H2,8,11,12) |
| InChIKey | DNERLGKONDKCNN-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(oxomethylidene)benzene-1,2-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(oxomethylidene)benzene-1,2-disulfonamide?
The IUPAC name of 2-N-(oxomethylidene)benzene-1,2-disulfonamide (CID 20532150) is 2-N-(oxomethylidene)benzene-1,2-disulfonamide.
What is the SMILES notation for 2-N-(oxomethylidene)benzene-1,2-disulfonamide?
The canonical SMILES for 2-N-(oxomethylidene)benzene-1,2-disulfonamide is NS(=O)(=O)c1ccccc1S(=O)(=O)N=C=O.
What is the InChIKey of 2-N-(oxomethylidene)benzene-1,2-disulfonamide?
The InChIKey is DNERLGKONDKCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O5S2/c8-15(11,12)6-3-1-2-4-7(6)16(13,14)9-5-10/h1-4H,(H2,8,11,12).
What are the key properties of 2-N-(oxomethylidene)benzene-1,2-disulfonamide?
2-N-(oxomethylidene)benzene-1,2-disulfonamide has a molecular weight of 262.27 g/mol, XLogP of -0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(oxomethylidene)benzene-1,2-disulfonamide is sourced from PubChem (CID 20532150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).