About N-butan-2-yl-1,3-dithiolan-2-imine
N-butan-2-yl-1,3-dithiolan-2-imine (PubChem CID 20532351) has the molecular formula C7H13NS2
and a molecular weight of 175.32 g/mol. Its IUPAC name is N-butan-2-yl-1,3-dithiolan-2-imine.
Molecular Properties
| Compound Name | N-butan-2-yl-1,3-dithiolan-2-imine |
| PubChem CID | 20532351 |
| Molecular Formula | C7H13NS2 |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | N-butan-2-yl-1,3-dithiolan-2-imine |
| SMILES | CCC(C)N=C1SCCS1 |
| InChI | InChI=1S/C7H13NS2/c1-3-6(2)8-7-9-4-5-10-7/h6H,3-5H2,1-2H3 |
| InChIKey | NFHVCQMRNYDDSO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-1,3-dithiolan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1,3-dithiolan-2-imine?
The IUPAC name of N-butan-2-yl-1,3-dithiolan-2-imine (CID 20532351) is N-butan-2-yl-1,3-dithiolan-2-imine.
What is the SMILES notation for N-butan-2-yl-1,3-dithiolan-2-imine?
The canonical SMILES for N-butan-2-yl-1,3-dithiolan-2-imine is CCC(C)N=C1SCCS1.
What is the InChIKey of N-butan-2-yl-1,3-dithiolan-2-imine?
The InChIKey is NFHVCQMRNYDDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS2/c1-3-6(2)8-7-9-4-5-10-7/h6H,3-5H2,1-2H3.
What are the key properties of N-butan-2-yl-1,3-dithiolan-2-imine?
N-butan-2-yl-1,3-dithiolan-2-imine has a molecular weight of 175.32 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1,3-dithiolan-2-imine is sourced from PubChem (CID 20532351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).