C13H26N6S — CID 20532615
4-N,6-N-ditert-butyl-2-N-ethylsulfanyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20532615) has the molecular formula C13H26N6S and a molecular weight of 298.46 g/mol. Its IUPAC name is 4-N,6-N-ditert-butyl-2-N-ethylsulfanyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-ditert-butyl-2-N-ethylsulfanyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20532615 |
| Molecular Formula | C13H26N6S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-N,6-N-ditert-butyl-2-N-ethylsulfanyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCSNc1nc(NC(C)(C)C)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C13H26N6S/c1-8-20-19-11-15-9(17-12(2,3)4)14-10(16-11)18-13(5,6)7/h8H2,1-7H3,(H3,14,15,16,17,18,19) |
| InChIKey | ACAFMTVYHGHYGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|