C14H28N6S — CID 20532629
4-N,6-N-ditert-butyl-2-N-propan-2-ylsulfanyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20532629) has the molecular formula C14H28N6S and a molecular weight of 312.49 g/mol. Its IUPAC name is 4-N,6-N-ditert-butyl-2-N-propan-2-ylsulfanyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-ditert-butyl-2-N-propan-2-ylsulfanyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20532629 |
| Molecular Formula | C14H28N6S |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4-N,6-N-ditert-butyl-2-N-propan-2-ylsulfanyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)SNc1nc(NC(C)(C)C)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C14H28N6S/c1-9(2)21-20-12-16-10(18-13(3,4)5)15-11(17-12)19-14(6,7)8/h9H,1-8H3,(H3,15,16,17,18,19,20) |
| InChIKey | OOUWCFFGPABMPC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|